![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | CityLogger_Report_Final.pdf | 2023-11-02 13:46 | 3.1M | |
| Continuous_Survey_Methods_Final.pdf | 2023-11-02 13:46 | 638K | |
| Core-Satellite_Report_Final.pdf | 2023-11-02 13:46 | 822K | |
| Current_State_of_Landline_Survey_Methods.pdf | 2023-11-02 13:46 | 581K | |
| Current_State_of_Landline_Survey_Methods_Annotated_Bibliography.pdf | 2023-11-02 13:46 | 937K | |
| Current_State_of_Smartphone_Survey_Methods.pdf | 2023-11-02 13:46 | 563K | |
| Current_State_of_Smartphone_Survey_Methods_Annotated_Bibliography.pdf | 2023-11-02 13:46 | 927K | |
| Current_State_of_Web_Based_Survey_Methods.pdf | 2023-11-02 13:46 | 740K | |
| Current_State_of_Web_Based_Survey_Methods_Appendices.pdf | 2023-11-02 13:46 | 1.4M | |
| DMG_TRAISI_report_v3.pdf | 2023-11-02 13:46 | 952K | |
| Data_Fusion_Report_Final.pdf | 2023-11-02 13:46 | 1.8M | |
| Impact_of_Multiple_Sample_Frames_on_Data_Quality_Report_Final.pdf | 2023-11-02 13:46 | 662K | |
| In-Person_Survey_Field_Test_Report_Final.pdf | 2023-11-02 13:46 | 1.6M | |
| Inverted_Sampling_Method_for_HTS_Final.pdf | 2023-11-02 13:46 | 1.7M | |
| Passive_Data_Report_Final.pdf | 2023-11-02 13:46 | 518K | |
| Sample_Frame_Report_Final.pdf | 2023-11-02 13:46 | 1.5M | |
| Sample_Size_Requirements_for_Regional_Household_Travel_Surveys.pdf | 2023-11-02 13:46 | 517K | |
| SmartPhones_Vol2_Final.pdf | 2023-11-02 13:46 | 9.1M | |
![[ ]](/icons/unknown.gif) | Structure and format of NOC 2016.docx | 2023-11-02 13:46 | 15K | |
| TTS2.0_Final_Report.pdf | 2023-11-02 13:46 | 2.3M | |
| Web_Survey_Design_Report_Final.pdf | 2023-11-02 13:46 | 1.3M | |
| Web_Survey_Field_Test_Report_Final.pdf | 2023-11-02 13:46 | 4.0M | |
|
|---|